CAS 12221-38-4 is the registry number for Basic Blue 66. Offered by: TRC. Available pack sizes: 250mg.
3-[2-[[4-(diethylamino)phenyl]diazenyl]-6-ethoxy-1,3-benzothiazol-3-ium-3-yl]propanamide chloride (CAS 12221-38-4) is a chemical compound with the molecular formula C22H28ClN5O2S and a molecular weight of 462.0 g/mol. IUPAC name: 3-[2-[[4-(diethylamino)phenyl]diazenyl]-6-ethoxy-1,3-benzothiazol-3-ium-3-yl]propanamide chloride. InChIKey: POELEEGOWIJNBI-UHFFFAOYSA-N.
| Molecular formula | C22H28ClN5O2S |
|---|---|
| Molecular weight | 462.0 g/mol |
| IUPAC name | 3-[2-[[4-(diethylamino)phenyl]diazenyl]-6-ethoxy-1,3-benzothiazol-3-ium-3-yl]propanamide chloride |
| InChIKey | POELEEGOWIJNBI-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC=C(C=C1)N=NC2=[N+](C3=C(S2)C=C(C=C3)OCC)CCC(=O)N.[Cl-] |
Computed by PubChem (NCBI)