CAS 1222533-74-5 is the registry number for 1-(6-Fluoro-3,4-dihydro-1,8-naphthyridin-1(2h)-yl)-2,2-dimethylpropan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(6-fluoro-3,4-dihydro-2H-1,8-naphthyridin-1-yl)-2,2-dimethylpropan-1-one (CAS 1222533-74-5) is a chemical compound with the molecular formula C13H17FN2O and a molecular weight of 236.28 g/mol. IUPAC name: 1-(6-fluoro-3,4-dihydro-2H-1,8-naphthyridin-1-yl)-2,2-dimethylpropan-1-one. InChIKey: IUBSHJRDDRRQFV-UHFFFAOYSA-N.
| Molecular formula | C13H17FN2O |
|---|---|
| Molecular weight | 236.28 g/mol |
| IUPAC name | 1-(6-fluoro-3,4-dihydro-2H-1,8-naphthyridin-1-yl)-2,2-dimethylpropan-1-one |
| InChIKey | IUBSHJRDDRRQFV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)N1CCCC2=C1N=CC(=C2)F |
Computed by PubChem (NCBI)