CAS 1222533-94-9 is the registry number for 6,8-Diiodo-3,4-dihydro-2h-pyrano[3,2-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6,8-diiodo-3,4-dihydro-2H-pyrano[3,2-b]pyridine (CAS 1222533-94-9) is a chemical compound with the molecular formula C8H7I2NO and a molecular weight of 386.96 g/mol. IUPAC name: 6,8-diiodo-3,4-dihydro-2H-pyrano[3,2-b]pyridine. InChIKey: TXCMSZYABRJNDO-UHFFFAOYSA-N.
| Molecular formula | C8H7I2NO |
|---|---|
| Molecular weight | 386.96 g/mol |
| IUPAC name | 6,8-diiodo-3,4-dihydro-2H-pyrano[3,2-b]pyridine |
| InChIKey | TXCMSZYABRJNDO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=N2)I)I)OC1 |
Computed by PubChem (NCBI)