CAS 1222630-50-3 is the registry number for (2-Ammonioethyl)diisopropylphosphonium ditetrafluoroborate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-di(propan-2-yl)phosphaniumylethylazanium ditetrafluoroborate (CAS 1222630-50-3) is a chemical compound with the molecular formula C8H22B2F8NP and a molecular weight of 336.86 g/mol. IUPAC name: 2-di(propan-2-yl)phosphaniumylethylazanium ditetrafluoroborate. InChIKey: FRNNRBJVGVIOPD-UHFFFAOYSA-P.
| Molecular formula | C8H22B2F8NP |
|---|---|
| Molecular weight | 336.86 g/mol |
| IUPAC name | 2-di(propan-2-yl)phosphaniumylethylazanium ditetrafluoroborate |
| InChIKey | FRNNRBJVGVIOPD-UHFFFAOYSA-P |
| SMILES | [B-](F)(F)(F)F.[B-](F)(F)(F)F.CC(C)[PH+](CC[NH3+])C(C)C |
Computed by PubChem (NCBI)