CAS 122305-64-0 appears in our catalog under these names: 4-Fluorobenzyl carbamimidothioate hydrochloride, 95%, 4-FLUOROBENZYL CARBAMIMIDOTHIOATE HCL, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g.
(4-fluorophenyl)methyl carbamimidothioate;hydrochloride (CAS 122305-64-0) is a chemical compound with the molecular formula C8H10ClFN2S and a molecular weight of 220.70 g/mol. IUPAC name: (4-fluorophenyl)methyl carbamimidothioate;hydrochloride. InChIKey: STUFCQTWEPJJSZ-UHFFFAOYSA-N.
| Molecular formula | C8H10ClFN2S |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | (4-fluorophenyl)methyl carbamimidothioate;hydrochloride |
| InChIKey | STUFCQTWEPJJSZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CSC(=N)N)F.Cl |
Computed by PubChem (NCBI)