Products 1223550-31-9
CAS 1223550-31-9 is the registry number for Antifungal agent 65. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-benzyl-3-[(1R,2R)-2-[(4-methylphenyl)sulfonylamino]-1,2-diphenylethyl]thiourea (CAS 1223550-31-9) is a chemical compound with the molecular formula C29H29N3O2S2 and a molecular weight of 515.7 g/mol. IUPAC name: 1-benzyl-3-[(1R,2R)-2-[(4-methylphenyl)sulfonylamino]-1,2-diphenylethyl]thiourea. InChIKey: LCSXABNCRFYUEF-VSGBNLITSA-N.
| Molecular formula | C29H29N3O2S2 |
|---|---|
| Molecular weight | 515.7 g/mol |
| IUPAC name | 1-benzyl-3-[(1R,2R)-2-[(4-methylphenyl)sulfonylamino]-1,2-diphenylethyl]thiourea |
| InChIKey | LCSXABNCRFYUEF-VSGBNLITSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@H](C2=CC=CC=C2)[C@@H](C3=CC=CC=C3)NC(=S)NCC4=CC=CC=C4 |
Computed by PubChem (NCBI)