CAS 122380-17-0 appears in our catalog under these names: 5-Chloro-2,6-dihydroxynicotinic acid, 98%, 5-Chloro-2,6-dihydroxynicotinic acid, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg.
5-chloro-2-hydroxy-6-oxo-1H-pyridine-3-carboxylic acid (CAS 122380-17-0) is a chemical compound with the molecular formula C6H4ClNO4 and a molecular weight of 189.55 g/mol. IUPAC name: 5-chloro-2-hydroxy-6-oxo-1H-pyridine-3-carboxylic acid. InChIKey: FPQSQLCMLVMEIS-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO4 |
|---|---|
| Molecular weight | 189.55 g/mol |
| IUPAC name | 5-chloro-2-hydroxy-6-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | FPQSQLCMLVMEIS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=C1C(=O)O)O)Cl |
Computed by PubChem (NCBI)