CAS 122380-33-0 appears in our catalog under these names: Histamine Impurity 1-d3, 2-(1-Methyl-1H-imidazol-4-yl)acetic acid-d3. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 5mg, 1mg.
2-[1-(trideuteriomethyl)imidazol-4-yl]acetic acid (CAS 122380-33-0) is a chemical compound with the molecular formula C6H8N2O2 and a molecular weight of 143.16 g/mol. IUPAC name: 2-[1-(trideuteriomethyl)imidazol-4-yl]acetic acid. InChIKey: ZHCKPJGJQOPTLB-FIBGUPNXSA-N.
| Molecular formula | C6H8N2O2 |
|---|---|
| Molecular weight | 143.16 g/mol |
| IUPAC name | 2-[1-(trideuteriomethyl)imidazol-4-yl]acetic acid |
| InChIKey | ZHCKPJGJQOPTLB-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=C(N=C1)CC(=O)O |
Computed by PubChem (NCBI)