Products 12240-99-2

CAS 12240-99-2 is the registry number for 7,9-Dimethylguanine Hemitosylate. Offered by: TRC. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Bis(2-amino-7,9-dimethylpurin-9-ium-6-olate);4-methylbenzenesulfonic acid (CAS 12240-99-2) is a chemical compound with the molecular formula C21H26N10O5S and a molecular weight of 530.6 g/mol. IUPAC name: bis(2-amino-7,9-dimethylpurin-9-ium-6-olate);4-methylbenzenesulfonic acid. InChIKey: IAENIIQKBLERCN-UHFFFAOYSA-N.

Identity
Molecular formulaC21H26N10O5S
Molecular weight530.6 g/mol
IUPAC namebis(2-amino-7,9-dimethylpurin-9-ium-6-olate);4-methylbenzenesulfonic acid
InChIKeyIAENIIQKBLERCN-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)O.CN1C=[N+](C2=C1C(=NC(=N2)N)[O-])C.CN1C=[N+](C2=C1C(=NC(=N2)N)[O-])C

Computed by PubChem (NCBI)