CAS 12240-99-2 is the registry number for 7,9-Dimethylguanine Hemitosylate. Offered by: TRC. Available pack sizes: 100mg, 1g.
Bis(2-amino-7,9-dimethylpurin-9-ium-6-olate);4-methylbenzenesulfonic acid (CAS 12240-99-2) is a chemical compound with the molecular formula C21H26N10O5S and a molecular weight of 530.6 g/mol. IUPAC name: bis(2-amino-7,9-dimethylpurin-9-ium-6-olate);4-methylbenzenesulfonic acid. InChIKey: IAENIIQKBLERCN-UHFFFAOYSA-N.
| Molecular formula | C21H26N10O5S |
|---|---|
| Molecular weight | 530.6 g/mol |
| IUPAC name | bis(2-amino-7,9-dimethylpurin-9-ium-6-olate);4-methylbenzenesulfonic acid |
| InChIKey | IAENIIQKBLERCN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CN1C=[N+](C2=C1C(=NC(=N2)N)[O-])C.CN1C=[N+](C2=C1C(=NC(=N2)N)[O-])C |
Computed by PubChem (NCBI)