Products 1224169-47-4

CAS 1224169-47-4 is the registry number for 2-(4-Amino-3,5-dimethyl-1h-pyrazol-1-yl)ethanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(4-amino-3,5-dimethylpyrazol-1-yl)ethanol;hydrochloride (CAS 1224169-47-4) is a chemical compound with the molecular formula C7H14ClN3O and a molecular weight of 191.66 g/mol. IUPAC name: 2-(4-amino-3,5-dimethylpyrazol-1-yl)ethanol;hydrochloride. InChIKey: WZHNTJHBGUAYTM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClN3O
Molecular weight191.66 g/mol
IUPAC name2-(4-amino-3,5-dimethylpyrazol-1-yl)ethanol;hydrochloride
InChIKeyWZHNTJHBGUAYTM-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1CCO)C)N.Cl

Computed by PubChem (NCBI)