CAS 1224568-02-8 appears in our catalog under these names: Cinacalcet Impurity 8, Cinacalcet Impurity 31. Offered by: Chemat Brand. Available pack sizes: on request.
3-[[(1R)-1-naphthalen-1-ylethyl]amino]-1-[3-(trifluoromethyl)phenyl]propan-1-ol (CAS 1224568-02-8) is a chemical compound with the molecular formula C22H22F3NO and a molecular weight of 373.4 g/mol. IUPAC name: 3-[[(1R)-1-naphthalen-1-ylethyl]amino]-1-[3-(trifluoromethyl)phenyl]propan-1-ol. InChIKey: XQDOEVUUPRKZSA-RBFZIWAESA-N.
| Molecular formula | C22H22F3NO |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 3-[[(1R)-1-naphthalen-1-ylethyl]amino]-1-[3-(trifluoromethyl)phenyl]propan-1-ol |
| InChIKey | XQDOEVUUPRKZSA-RBFZIWAESA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)NCCC(C3=CC(=CC=C3)C(F)(F)F)O |
Computed by PubChem (NCBI)