CAS 1224573-44-7 is the registry number for 3,6-Di(thiazol-2-yl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
3-hydroxy-1,4-bis(1,3-thiazol-2-yl)-2H-pyrrolo[3,4-c]pyrrol-6-one (CAS 1224573-44-7) is a chemical compound with the molecular formula C12H6N4O2S2 and a molecular weight of 302.3 g/mol. IUPAC name: 3-hydroxy-1,4-bis(1,3-thiazol-2-yl)-2H-pyrrolo[3,4-c]pyrrol-6-one. InChIKey: TZFNPXMFSAFCES-UHFFFAOYSA-N.
| Molecular formula | C12H6N4O2S2 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | 3-hydroxy-1,4-bis(1,3-thiazol-2-yl)-2H-pyrrolo[3,4-c]pyrrol-6-one |
| InChIKey | TZFNPXMFSAFCES-UHFFFAOYSA-N |
| SMILES | C1=CSC(=N1)C2=C3C(=C(N2)O)C(=NC3=O)C4=NC=CS4 |
Computed by PubChem (NCBI)