CAS 1224637-04-0 is the registry number for N-Ethyl Prolinamide-d5. Offered by: TRC. Available pack sizes: 25mg.
1-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2-carboxamide (CAS 1224637-04-0) is a chemical compound with the molecular formula C7H14N2O and a molecular weight of 147.23 g/mol. IUPAC name: 1-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2-carboxamide. InChIKey: LQOASEHNECNLNM-ZBJDZAJPSA-N.
| Molecular formula | C7H14N2O |
|---|---|
| Molecular weight | 147.23 g/mol |
| IUPAC name | 1-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2-carboxamide |
| InChIKey | LQOASEHNECNLNM-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1CCCC1C(=O)N |
Computed by PubChem (NCBI)