CAS 122475-42-7 is the registry number for 4-o-(3-Nitropropanoyl)corollin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 25mg, Get quote.
[6-hydroxy-3,4,5-tris(3-nitropropanoyloxy)oxan-2-yl]methyl 3-nitropropanoate (CAS 122475-42-7) is a chemical compound with the molecular formula C18H24N4O18 and a molecular weight of 584.4 g/mol. IUPAC name: [6-hydroxy-3,4,5-tris(3-nitropropanoyloxy)oxan-2-yl]methyl 3-nitropropanoate. InChIKey: JMPKPWBLQUWFHQ-UHFFFAOYSA-N.
| Molecular formula | C18H24N4O18 |
|---|---|
| Molecular weight | 584.4 g/mol |
| IUPAC name | [6-hydroxy-3,4,5-tris(3-nitropropanoyloxy)oxan-2-yl]methyl 3-nitropropanoate |
| InChIKey | JMPKPWBLQUWFHQ-UHFFFAOYSA-N |
| SMILES | C(C[N+](=O)[O-])C(=O)OCC1C(C(C(C(O1)O)OC(=O)CC[N+](=O)[O-])OC(=O)CC[N+](=O)[O-])OC(=O)CC[N+](=O)[O-] |
Computed by PubChem (NCBI)