CAS 1224945-46-3 is the registry number for (R)-Tert-Butyl 2-(2-Bromophenyl)Pyrrolidine-1-Carboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl (2R)-2-(2-bromophenyl)pyrrolidine-1-carboxylate (CAS 1224945-46-3) is a chemical compound with the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. IUPAC name: tert-butyl (2R)-2-(2-bromophenyl)pyrrolidine-1-carboxylate. InChIKey: RNZCQSVBUGGMJB-CYBMUJFWSA-N.
| Molecular formula | C15H20BrNO2 |
|---|---|
| Molecular weight | 326.23 g/mol |
| IUPAC name | tert-butyl (2R)-2-(2-bromophenyl)pyrrolidine-1-carboxylate |
| InChIKey | RNZCQSVBUGGMJB-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1C2=CC=CC=C2Br |
Computed by PubChem (NCBI)