Products 122497-17-0

CAS 122497-17-0 is the registry number for Famciclovir Impurity 39. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Triethyl 3-(2-amino-6-chloropurin-9-yl)propane-1,1,1-tricarboxylate (CAS 122497-17-0) is a chemical compound with the molecular formula C17H22ClN5O6 and a molecular weight of 427.8 g/mol. IUPAC name: triethyl 3-(2-amino-6-chloropurin-9-yl)propane-1,1,1-tricarboxylate. InChIKey: OZEJVERUHWUZSP-UHFFFAOYSA-N.

Identity
Molecular formulaC17H22ClN5O6
Molecular weight427.8 g/mol
IUPAC nametriethyl 3-(2-amino-6-chloropurin-9-yl)propane-1,1,1-tricarboxylate
InChIKeyOZEJVERUHWUZSP-UHFFFAOYSA-N
SMILESCCOC(=O)C(CCN1C=NC2=C1N=C(N=C2Cl)N)(C(=O)OCC)C(=O)OCC

Computed by PubChem (NCBI)