CAS 1225-20-3 appears in our catalog under these names: Sodium Iothalamate, Iothalamate (sodium). Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 1 mg, 10 mg, 25 mg, 5 mg.
Sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate (CAS 1225-20-3) is a chemical compound with the molecular formula C11H8I3N2NaO4 and a molecular weight of 635.89 g/mol. IUPAC name: sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate. InChIKey: WCIMWHNSWLLELS-UHFFFAOYSA-M.
| Molecular formula | C11H8I3N2NaO4 |
|---|---|
| Molecular weight | 635.89 g/mol |
| IUPAC name | sodium 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate |
| InChIKey | WCIMWHNSWLLELS-UHFFFAOYSA-M |
| SMILES | CC(=O)NC1=C(C(=C(C(=C1I)C(=O)[O-])I)C(=O)NC)I.[Na+] |
Computed by PubChem (NCBI)