CAS 1225040-02-7 is the registry number for 4-Bromo-2-fluoro-n-(4-methoxybenzyl)benzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-bromo-2-fluoro-N-[(4-methoxyphenyl)methyl]benzenesulfonamide (CAS 1225040-02-7) is a chemical compound with the molecular formula C14H13BrFNO3S and a molecular weight of 374.23 g/mol. IUPAC name: 4-bromo-2-fluoro-N-[(4-methoxyphenyl)methyl]benzenesulfonamide. InChIKey: HLWUHIKBKOTOCQ-UHFFFAOYSA-N.
| Molecular formula | C14H13BrFNO3S |
|---|---|
| Molecular weight | 374.23 g/mol |
| IUPAC name | 4-bromo-2-fluoro-N-[(4-methoxyphenyl)methyl]benzenesulfonamide |
| InChIKey | HLWUHIKBKOTOCQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNS(=O)(=O)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)