CAS 1225041-14-4 appears in our catalog under these names: 2-(Trifluoromethyl)-1,3-benzothiazole-6-carbonitrile, 95%, 2-(Trifluoromethyl)-1,3-benzothiazole-6-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile (CAS 1225041-14-4) is a chemical compound with the molecular formula C9H3F3N2S and a molecular weight of 228.20 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile. InChIKey: YJKPNMFSTDCJRV-UHFFFAOYSA-N.
| Molecular formula | C9H3F3N2S |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-benzothiazole-6-carbonitrile |
| InChIKey | YJKPNMFSTDCJRV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)SC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)