CAS 1225203-47-3 appears in our catalog under these names: 2,3,7,8-Tetrafluorothianthrene 97%, 2,3,7,8-Tetrafluorothianthrene, 97%, 97%, 2,3,7,8-Tetrafluorothianthrene, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,3,7,8-tetrafluorothianthrene (CAS 1225203-47-3) is a chemical compound with the molecular formula C12H4F4S2 and a molecular weight of 288.3 g/mol. IUPAC name: 2,3,7,8-tetrafluorothianthrene. InChIKey: HQZXWPYBTPTQFT-UHFFFAOYSA-N.
| Molecular formula | C12H4F4S2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 2,3,7,8-tetrafluorothianthrene |
| InChIKey | HQZXWPYBTPTQFT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1SC3=C(S2)C=C(C(=C3)F)F)F)F |
Computed by PubChem (NCBI)