CAS 1225383-33-4 appears in our catalog under these names: E3 ligase Ligand 8, 98%, E3 ligase Ligand 8/ 98.86% (existing batch purity), E3 Ligase ligand 8, E3 ligase Ligand 8, 99.32%. Offered by: AmBeed, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1g, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 5mg.
(2S)-2-[[(2S,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid (CAS 1225383-33-4) is a chemical compound with the molecular formula C31H34N2O6 and a molecular weight of 530.6 g/mol. IUPAC name: (2S)-2-[[(2S,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid. InChIKey: DYKHBFJZCIEBJE-PKTNWEFCSA-N.
| Molecular formula | C31H34N2O6 |
|---|---|
| Molecular weight | 530.6 g/mol |
| IUPAC name | (2S)-2-[[(2S,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid |
| InChIKey | DYKHBFJZCIEBJE-PKTNWEFCSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H]([C@@H](CC1=CC=CC=C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)