CAS 1225383-64-1 appears in our catalog under these names: Etravirine Impurity 2, Etravirine Impurity 12. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[2-chloro-6-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile (CAS 1225383-64-1) is a chemical compound with the molecular formula C20H14ClN5O and a molecular weight of 375.8 g/mol. IUPAC name: 4-[2-chloro-6-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile. InChIKey: CVCIISGTGYWJHF-UHFFFAOYSA-N.
| Molecular formula | C20H14ClN5O |
|---|---|
| Molecular weight | 375.8 g/mol |
| IUPAC name | 4-[2-chloro-6-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile |
| InChIKey | CVCIISGTGYWJHF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC2=NC(=NC(=C2)NC3=CC=C(C=C3)C#N)Cl)C)C#N |
Computed by PubChem (NCBI)