CAS 1225431-64-0 is the registry number for (S)-2',3'-Dihydrospiro[cyclohexane-1,1'-inden]-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-spiro[1,2-dihydroindene-3,3'-cyclohexane]-1'-one (CAS 1225431-64-0) is a chemical compound with the molecular formula C14H16O and a molecular weight of 200.28 g/mol. IUPAC name: (3S)-spiro[1,2-dihydroindene-3,3'-cyclohexane]-1'-one. InChIKey: XUYLNTHOVXRDMY-AWEZNQCLSA-N.
| Molecular formula | C14H16O |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | (3S)-spiro[1,2-dihydroindene-3,3'-cyclohexane]-1'-one |
| InChIKey | XUYLNTHOVXRDMY-AWEZNQCLSA-N |
| SMILES | C1CC(=O)C[C@]2(C1)CCC3=CC=CC=C23 |
Computed by PubChem (NCBI)