CAS 122549-42-2 appears in our catalog under these names: Dimethyl 4-(4-fluorophenyl)-2,6-diisopropylpyridine-3,5-dicarboxylate, 97%, Dimethyl 2,6-Diisopropyl-4-(4-fluorophenyl)-pyridine-3,5-dicarboxylate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
Dimethyl 4-(4-fluorophenyl)-2,6-di(propan-2-yl)pyridine-3,5-dicarboxylate (CAS 122549-42-2) is a chemical compound with the molecular formula C21H24FNO4 and a molecular weight of 373.4 g/mol. IUPAC name: dimethyl 4-(4-fluorophenyl)-2,6-di(propan-2-yl)pyridine-3,5-dicarboxylate. InChIKey: UWVBURCRJLZZKT-UHFFFAOYSA-N.
| Molecular formula | C21H24FNO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | dimethyl 4-(4-fluorophenyl)-2,6-di(propan-2-yl)pyridine-3,5-dicarboxylate |
| InChIKey | UWVBURCRJLZZKT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=C(C(=N1)C(C)C)C(=O)OC)C2=CC=C(C=C2)F)C(=O)OC |
Computed by PubChem (NCBI)