CAS 1225493-18-4 appears in our catalog under these names: (2–(4–Ethynylphenyl)ethene–1,1,2–triyl)tribenzene, (2-(4-Ethynylphenyl)ethene-1,1,2-triyl)tribenzene, 96%, (2-(4-Ethynylphenyl)ethene-1,1,2-triyl)tribenzene, 97%, (2-(4-Ethynylphenyl)ethene-1,1,2-triyl)tribenzene, 97%, 97%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 50mg, 5g, 100mg, 500mg.
1-ethynyl-4-(1,2,2-triphenylethenyl)benzene (CAS 1225493-18-4) is a chemical compound with the molecular formula C28H20 and a molecular weight of 356.5 g/mol. IUPAC name: 1-ethynyl-4-(1,2,2-triphenylethenyl)benzene. InChIKey: FAHRYGJKAWVULP-UHFFFAOYSA-N.
| Molecular formula | C28H20 |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | 1-ethynyl-4-(1,2,2-triphenylethenyl)benzene |
| InChIKey | FAHRYGJKAWVULP-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)