Products 1225506-32-0
CAS 1225506-32-0 appears in our catalog under these names: 1-((4-Fluorophenyl)methyl)cyclopentane-1-carboxylic acid, 1-(4-Fluorobenzyl)cyclopentane-1-carboxylic acid, 95%, 1-[(4-fluorophenyl)methyl]cyclopentane-1-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg.
1-[(4-fluorophenyl)methyl]cyclopentane-1-carboxylic acid (CAS 1225506-32-0) is a chemical compound with the molecular formula C13H15FO2 and a molecular weight of 222.25 g/mol. IUPAC name: 1-[(4-fluorophenyl)methyl]cyclopentane-1-carboxylic acid. InChIKey: KNKZWRPVYPXRBJ-UHFFFAOYSA-N.
| Molecular formula | C13H15FO2 |
|---|---|
| Molecular weight | 222.25 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)methyl]cyclopentane-1-carboxylic acid |
| InChIKey | KNKZWRPVYPXRBJ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(CC2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)