CAS 122555-91-3 appears in our catalog under these names: Gadobutrol Impurity 23, Tri-tert-butyl 1,4,7,10-Tetraazacyclododecane-1,4,7-triacetate, >95% (HPLC), DO3A tert-Butyl ester, DO3A tert–Butyl ester (DO3A tert–butyl), 1,4,7-Tris(tert-butoxycarbonylmethyl)-1,4,7,10-tetraazacyclo. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 250mg, 10mg, 25mg, 1g, 500mg, 50g, 25g.
Tert-butyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate (CAS 122555-91-3) is a chemical compound with the molecular formula C26H50N4O6 and a molecular weight of 514.7 g/mol. IUPAC name: tert-butyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate. InChIKey: NMHVTLJFPDOJOD-UHFFFAOYSA-N.
| Molecular formula | C26H50N4O6 |
|---|---|
| Molecular weight | 514.7 g/mol |
| IUPAC name | tert-butyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| InChIKey | NMHVTLJFPDOJOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN1CCNCCN(CCN(CC1)CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)