Products 1225816-92-1
CAS 1225816-92-1 is the registry number for Piperidin-3-yl(4-(trifluoromethyl)phenyl)methanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Piperidin-3-yl-[4-(trifluoromethyl)phenyl]methanone (CAS 1225816-92-1) is a chemical compound with the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. IUPAC name: piperidin-3-yl-[4-(trifluoromethyl)phenyl]methanone. InChIKey: BGUUQDKRCNYJFQ-UHFFFAOYSA-N.
| Molecular formula | C13H14F3NO |
|---|---|
| Molecular weight | 257.25 g/mol |
| IUPAC name | piperidin-3-yl-[4-(trifluoromethyl)phenyl]methanone |
| InChIKey | BGUUQDKRCNYJFQ-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C(=O)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)