CAS 1225913-88-1 is the registry number for 1-(2,4-Dimethylphenyl)-2-(ethylamino)-1-propanone. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg.
1-(2,4-dimethylphenyl)-2-(ethylamino)propan-1-one (CAS 1225913-88-1) is a chemical compound with the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)-2-(ethylamino)propan-1-one. InChIKey: SJPGBKUKQFPPPH-UHFFFAOYSA-N.
| Molecular formula | C13H19NO |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)-2-(ethylamino)propan-1-one |
| InChIKey | SJPGBKUKQFPPPH-UHFFFAOYSA-N |
| SMILES | CCNC(C)C(=O)C1=C(C=C(C=C1)C)C |
Computed by PubChem (NCBI)