CAS 122599-20-6 is the registry number for 3-Chloro-2-(pyrrolidin-1-yl)-5-(trifluoromethyl)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
3-chloro-2-pyrrolidin-1-yl-5-(trifluoromethyl)pyridine (CAS 122599-20-6) is a chemical compound with the molecular formula C10H10ClF3N2 and a molecular weight of 250.65 g/mol. IUPAC name: 3-chloro-2-pyrrolidin-1-yl-5-(trifluoromethyl)pyridine. InChIKey: UMVFBUGPBBBBBB-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF3N2 |
|---|---|
| Molecular weight | 250.65 g/mol |
| IUPAC name | 3-chloro-2-pyrrolidin-1-yl-5-(trifluoromethyl)pyridine |
| InChIKey | UMVFBUGPBBBBBB-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)