CAS 1226067-99-7 appears in our catalog under these names: 6-Bromo-4-chloro-1,3-benzoxazole, 95%, 6-Bromo-4-chloro-1,3-benzoxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-bromo-4-chloro-1,3-benzoxazole (CAS 1226067-99-7) is a chemical compound with the molecular formula C7H3BrClNO and a molecular weight of 232.46 g/mol. IUPAC name: 6-bromo-4-chloro-1,3-benzoxazole. InChIKey: CENCUNFSRYXZDJ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 6-bromo-4-chloro-1,3-benzoxazole |
| InChIKey | CENCUNFSRYXZDJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1OC=N2)Cl)Br |
Computed by PubChem (NCBI)