Products 1226072-26-9
CAS 1226072-26-9 appears in our catalog under these names: 5-Bromo-7-chloro-1,3-benzoxazole, 5-Bromo-7-chloro-1,3-benzoxazole, 95%, 95%, 5-Bromo-7-chlorobenzo[d]oxazole, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 1g.
5-bromo-7-chloro-1,3-benzoxazole (CAS 1226072-26-9) is a chemical compound with the molecular formula C7H3BrClNO and a molecular weight of 232.46 g/mol. IUPAC name: 5-bromo-7-chloro-1,3-benzoxazole. InChIKey: MJTVJTQVFMVSFZ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 5-bromo-7-chloro-1,3-benzoxazole |
| InChIKey | MJTVJTQVFMVSFZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=CO2)Cl)Br |
Computed by PubChem (NCBI)