CAS 12261-30-2 is the registry number for (Cyclopentadienyl)(triethylphosphine)copper. Offered by: GLPBio. Available pack sizes: 1g.
Copper(1+);cyclopenta-1,3-diene;triethylphosphane (CAS 12261-30-2) is a chemical compound with the molecular formula C11H20CuP and a molecular weight of 246.80 g/mol. IUPAC name: copper(1+);cyclopenta-1,3-diene;triethylphosphane. InChIKey: HFLGHHCQULGGMX-UHFFFAOYSA-N.
| Molecular formula | C11H20CuP |
|---|---|
| Molecular weight | 246.80 g/mol |
| IUPAC name | copper(1+);cyclopenta-1,3-diene;triethylphosphane |
| InChIKey | HFLGHHCQULGGMX-UHFFFAOYSA-N |
| SMILES | CCP(CC)CC.[CH-]1C=CC=C1.[Cu+] |
Computed by PubChem (NCBI)