Products 1226388-07-3

CAS 1226388-07-3 is the registry number for 1-(difluoromethoxy)-2,3-dimethylbenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

1-(difluoromethoxy)-2,3-dimethylbenzene (CAS 1226388-07-3) is a chemical compound with the molecular formula C9H10F2O and a molecular weight of 172.17 g/mol. IUPAC name: 1-(difluoromethoxy)-2,3-dimethylbenzene. InChIKey: MLNPLJDIBGXLKI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10F2O
Molecular weight172.17 g/mol
IUPAC name1-(difluoromethoxy)-2,3-dimethylbenzene
InChIKeyMLNPLJDIBGXLKI-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)OC(F)F)C

Computed by PubChem (NCBI)