CAS 1226499-98-4 appears in our catalog under these names: Pazopanib Impurity 19, Pazopanib Impurity 10, N2,N4-Bis(2,3-dimethyl-2H-indazol-6-yl)-2,4-pyrimidinediamine, Pazopanib Impurity 10 HCl. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
2-N,4-N-bis(2,3-dimethylindazol-6-yl)pyrimidine-2,4-diamine (CAS 1226499-98-4) is a chemical compound with the molecular formula C22H22N8 and a molecular weight of 398.5 g/mol. IUPAC name: 2-N,4-N-bis(2,3-dimethylindazol-6-yl)pyrimidine-2,4-diamine. InChIKey: SWDMLVIYKQGRSC-UHFFFAOYSA-N.
| Molecular formula | C22H22N8 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | 2-N,4-N-bis(2,3-dimethylindazol-6-yl)pyrimidine-2,4-diamine |
| InChIKey | SWDMLVIYKQGRSC-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=CC2=NN1C)NC3=NC(=NC=C3)NC4=CC5=NN(C(=C5C=C4)C)C |
Computed by PubChem (NCBI)