Products 122654-30-2
CAS 122654-30-2 is the registry number for 2-Chloro-3’-deoxy-3’-fluoroadenosine. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg, 10 mg.
(2R,3S,4S,5R)-2-(6-amino-2-chloropurin-9-yl)-4-fluoro-5-(hydroxymethyl)oxolan-3-ol (CAS 122654-30-2) is a chemical compound with the molecular formula C10H11ClFN5O3 and a molecular weight of 303.68 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(6-amino-2-chloropurin-9-yl)-4-fluoro-5-(hydroxymethyl)oxolan-3-ol. InChIKey: IRHXEJNSFOBHLE-DXTOWSMRSA-N.
| Molecular formula | C10H11ClFN5O3 |
|---|---|
| Molecular weight | 303.68 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(6-amino-2-chloropurin-9-yl)-4-fluoro-5-(hydroxymethyl)oxolan-3-ol |
| InChIKey | IRHXEJNSFOBHLE-DXTOWSMRSA-N |
| SMILES | C1=NC2=C(N=C(N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)F)O)Cl)N |
Computed by PubChem (NCBI)