CAS 122664-96-4 is the registry number for 4’-Hydroxy-PhIP-O-sulfate. Offered by: TRC. Available pack sizes: 75mg.
[4-(2-amino-1-methylimidazo[4,5-b]pyridin-6-yl)phenyl] hydrogen sulfate (CAS 122664-96-4) is a chemical compound with the molecular formula C13H12N4O4S and a molecular weight of 320.33 g/mol. IUPAC name: [4-(2-amino-1-methylimidazo[4,5-b]pyridin-6-yl)phenyl] hydrogen sulfate. InChIKey: SSEWDBILXMYUPG-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O4S |
|---|---|
| Molecular weight | 320.33 g/mol |
| IUPAC name | [4-(2-amino-1-methylimidazo[4,5-b]pyridin-6-yl)phenyl] hydrogen sulfate |
| InChIKey | SSEWDBILXMYUPG-UHFFFAOYSA-N |
| SMILES | CN1C2=C(N=CC(=C2)C3=CC=C(C=C3)OS(=O)(=O)O)N=C1N |
Computed by PubChem (NCBI)