Products 122665-73-0
CAS 122665-73-0 is the registry number for CMDA. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[4-[2-chloroethyl(2-methylsulfonyloxyethyl)amino]benzoyl]amino]pentanedioic acid (CAS 122665-73-0) is a chemical compound with the molecular formula C17H23ClN2O8S and a molecular weight of 450.9 g/mol. IUPAC name: (2S)-2-[[4-[2-chloroethyl(2-methylsulfonyloxyethyl)amino]benzoyl]amino]pentanedioic acid. InChIKey: QVWYCTGTGHDWFQ-AWEZNQCLSA-N.
| Molecular formula | C17H23ClN2O8S |
|---|---|
| Molecular weight | 450.9 g/mol |
| IUPAC name | (2S)-2-[[4-[2-chloroethyl(2-methylsulfonyloxyethyl)amino]benzoyl]amino]pentanedioic acid |
| InChIKey | QVWYCTGTGHDWFQ-AWEZNQCLSA-N |
| SMILES | CS(=O)(=O)OCCN(CCCl)C1=CC=C(C=C1)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)