CAS 1226776-85-7 appears in our catalog under these names: 2-(Boc-amino)-4-(aminomethyl)pyridine dihydrochloride, 95%, 2-(Boc-amino)-4-(aminomethyl)pyridine Dihydrochloride, 98%, 2–(Boc–amino)–4–(aminomethyl)pyridine Dihydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 250mg.
Tert-butyl N-[4-(aminomethyl)-2-pyridinyl]carbamate;dihydrochloride (CAS 1226776-85-7) is a chemical compound with the molecular formula C11H19Cl2N3O2 and a molecular weight of 296.19 g/mol. IUPAC name: tert-butyl N-[4-(aminomethyl)-2-pyridinyl]carbamate;dihydrochloride. InChIKey: XPXSIFJOJBGGHM-UHFFFAOYSA-N.
| Molecular formula | C11H19Cl2N3O2 |
|---|---|
| Molecular weight | 296.19 g/mol |
| IUPAC name | tert-butyl N-[4-(aminomethyl)-2-pyridinyl]carbamate;dihydrochloride |
| InChIKey | XPXSIFJOJBGGHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=CC(=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)