CAS 1226776-93-7 appears in our catalog under these names: 2-Methoxy-4-(trifluoromethyl)thiazole-5-carboxylic acid, 95%, 2-Methoxy-4-(trifluoromethyl)thiazole-5-carboxylic acid, 98%, 2–Methoxy–4–(trifluoromethyl)thiazole–5–carboxylic Acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 250mg.
2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS 1226776-93-7) is a chemical compound with the molecular formula C6H4F3NO3S and a molecular weight of 227.16 g/mol. IUPAC name: 2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: DAGFIURSOZGKLT-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO3S |
|---|---|
| Molecular weight | 227.16 g/mol |
| IUPAC name | 2-methoxy-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | DAGFIURSOZGKLT-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(S1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)