Products 122712-71-4
CAS 122712-71-4 is the registry number for N6-Benzoyl-3'-fluoro-2',3'-dideoxyadenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[9-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide (CAS 122712-71-4) is a chemical compound with the molecular formula C17H16FN5O3 and a molecular weight of 357.34 g/mol. IUPAC name: N-[9-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide. InChIKey: RWKXHBQARYLBBO-YNEHKIRRSA-N.
| Molecular formula | C17H16FN5O3 |
|---|---|
| Molecular weight | 357.34 g/mol |
| IUPAC name | N-[9-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
| InChIKey | RWKXHBQARYLBBO-YNEHKIRRSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)CO)F |
Computed by PubChem (NCBI)