CAS 1227163-56-5 appears in our catalog under these names: AZD3839, Azd3839, 95%, (Rac)-AZD3839. Offered by: GLPBio, Combi-blocks, TRC, MedChemExpress. Available pack sizes: 5mg, 50mg, 10mg, 25mg, 5 mg, 25 mg, 10 mg.
7-fluoro-3-(3-pyrimidin-5-ylphenyl)-3-[2-(trifluoromethyl)-4-pyridinyl]isoindol-1-amine (CAS 1227163-56-5) is a chemical compound with the molecular formula C24H15F4N5 and a molecular weight of 449.4 g/mol. IUPAC name: 7-fluoro-3-(3-pyrimidin-5-ylphenyl)-3-[2-(trifluoromethyl)-4-pyridinyl]isoindol-1-amine. InChIKey: KJPBADHCKFUMIL-UHFFFAOYSA-N.
| Molecular formula | C24H15F4N5 |
|---|---|
| Molecular weight | 449.4 g/mol |
| IUPAC name | 7-fluoro-3-(3-pyrimidin-5-ylphenyl)-3-[2-(trifluoromethyl)-4-pyridinyl]isoindol-1-amine |
| InChIKey | KJPBADHCKFUMIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2(C3=C(C(=CC=C3)F)C(=N2)N)C4=CC(=NC=C4)C(F)(F)F)C5=CN=CN=C5 |
Computed by PubChem (NCBI)