CAS 122731-74-2 is the registry number for Iohexol Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-3-N-(2,3-dihydroxypropyl)benzene-1,3-dicarboxamide;hydrochloride (CAS 122731-74-2) is a chemical compound with the molecular formula C11H16ClN3O4 and a molecular weight of 289.71 g/mol. IUPAC name: 5-amino-3-N-(2,3-dihydroxypropyl)benzene-1,3-dicarboxamide;hydrochloride. InChIKey: YGOPODVXULNSCW-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O4 |
|---|---|
| Molecular weight | 289.71 g/mol |
| IUPAC name | 5-amino-3-N-(2,3-dihydroxypropyl)benzene-1,3-dicarboxamide;hydrochloride |
| InChIKey | YGOPODVXULNSCW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)NCC(CO)O)N)C(=O)N.Cl |
Computed by PubChem (NCBI)