CAS 1227375-87-2 is the registry number for 2-Chloro-5-(2,4-dichlorophenyl)phenol, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-chloro-5-(2,4-dichlorophenyl)phenol (CAS 1227375-87-2) is a chemical compound with the molecular formula C12H7Cl3O and a molecular weight of 273.5 g/mol. IUPAC name: 2-chloro-5-(2,4-dichlorophenyl)phenol. InChIKey: ZLKBSRDGBIPMSV-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl3O |
|---|---|
| Molecular weight | 273.5 g/mol |
| IUPAC name | 2-chloro-5-(2,4-dichlorophenyl)phenol |
| InChIKey | ZLKBSRDGBIPMSV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C=C(C=C2)Cl)Cl)O)Cl |
Computed by PubChem (NCBI)