CAS 1227407-69-3 is the registry number for Pentafluorophenyl 3-Fluoro-cyclooctyne 3-Carboxylate. Offered by: TRC. Available pack sizes: 2,5g.
(2,3,4,5,6-pentafluorophenyl) 1-fluorocyclooct-2-yne-1-carboxylate (CAS 1227407-69-3) is a chemical compound with the molecular formula C15H10F6O2 and a molecular weight of 336.23 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 1-fluorocyclooct-2-yne-1-carboxylate. InChIKey: DPHYLFAZMCYADI-UHFFFAOYSA-N.
| Molecular formula | C15H10F6O2 |
|---|---|
| Molecular weight | 336.23 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 1-fluorocyclooct-2-yne-1-carboxylate |
| InChIKey | DPHYLFAZMCYADI-UHFFFAOYSA-N |
| SMILES | C1CCC#CC(CC1)(C(=O)OC2=C(C(=C(C(=C2F)F)F)F)F)F |
Computed by PubChem (NCBI)