Products 1227407-71-7

CAS 1227407-71-7 is the registry number for Methyl 1-fluoro-2-oxocyclooctane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 1-fluoro-2-oxocyclooctane-1-carboxylate (CAS 1227407-71-7) is a chemical compound with the molecular formula C10H15FO3 and a molecular weight of 202.22 g/mol. IUPAC name: methyl 1-fluoro-2-oxocyclooctane-1-carboxylate. InChIKey: QALOVNLUOJPBGW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15FO3
Molecular weight202.22 g/mol
IUPAC namemethyl 1-fluoro-2-oxocyclooctane-1-carboxylate
InChIKeyQALOVNLUOJPBGW-UHFFFAOYSA-N
SMILESCOC(=O)C1(CCCCCCC1=O)F

Computed by PubChem (NCBI)