CAS 1227465-55-5 is the registry number for 5-[Amino(phenyl)methyl]-1,3,4-thiadiazol-2-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-[amino(phenyl)methyl]-1,3,4-thiadiazol-2-amine;dihydrochloride (CAS 1227465-55-5) is a chemical compound with the molecular formula C9H12Cl2N4S and a molecular weight of 279.19 g/mol. IUPAC name: 5-[amino(phenyl)methyl]-1,3,4-thiadiazol-2-amine;dihydrochloride. InChIKey: NNRRIJQAGHVEMP-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N4S |
|---|---|
| Molecular weight | 279.19 g/mol |
| IUPAC name | 5-[amino(phenyl)methyl]-1,3,4-thiadiazol-2-amine;dihydrochloride |
| InChIKey | NNRRIJQAGHVEMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=NN=C(S2)N)N.Cl.Cl |
Computed by PubChem (NCBI)