Products 1227571-57-4
CAS 1227571-57-4 is the registry number for 3-Bromo-6-iodo-2-(trifluoromethyl)pyridine, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
3-bromo-6-iodo-2-(trifluoromethyl)pyridine (CAS 1227571-57-4) is a chemical compound with the molecular formula C6H2BrF3IN and a molecular weight of 351.89 g/mol. IUPAC name: 3-bromo-6-iodo-2-(trifluoromethyl)pyridine. InChIKey: RAIVJZNGKONIDR-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF3IN |
|---|---|
| Molecular weight | 351.89 g/mol |
| IUPAC name | 3-bromo-6-iodo-2-(trifluoromethyl)pyridine |
| InChIKey | RAIVJZNGKONIDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Br)C(F)(F)F)I |
Computed by PubChem (NCBI)