Products 1227574-46-0
CAS 1227574-46-0 is the registry number for 2-Chloro-4-fluoro-3-(trifluoromethyl)pyridine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-chloro-4-fluoro-3-(trifluoromethyl)pyridine (CAS 1227574-46-0) is a chemical compound with the molecular formula C6H2ClF4N and a molecular weight of 199.53 g/mol. IUPAC name: 2-chloro-4-fluoro-3-(trifluoromethyl)pyridine. InChIKey: GAWLMPJOUJYZSV-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF4N |
|---|---|
| Molecular weight | 199.53 g/mol |
| IUPAC name | 2-chloro-4-fluoro-3-(trifluoromethyl)pyridine |
| InChIKey | GAWLMPJOUJYZSV-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1F)C(F)(F)F)Cl |
Computed by PubChem (NCBI)