CAS 1227580-43-9 is the registry number for 4-Chloro-2-fluoro-5-(trifluoromethyl)pyridine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-2-fluoro-5-(trifluoromethyl)pyridine (CAS 1227580-43-9) is a chemical compound with the molecular formula C6H2ClF4N and a molecular weight of 199.53 g/mol. IUPAC name: 4-chloro-2-fluoro-5-(trifluoromethyl)pyridine. InChIKey: XSPVRBOLPGXECP-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF4N |
|---|---|
| Molecular weight | 199.53 g/mol |
| IUPAC name | 4-chloro-2-fluoro-5-(trifluoromethyl)pyridine |
| InChIKey | XSPVRBOLPGXECP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1F)C(F)(F)F)Cl |
Computed by PubChem (NCBI)